ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95-08-9 2,2'-에틸렌디옥시디에틸 비스(2-에틸부티레이트) |
|
상품명칭 | 2,2'-에틸렌디옥시디에틸 비스(2-에틸부티레이트) |
별명 | 트리 에틸렌 글리콜 비스 (2- 에틸 부티레이트); 2,2'-(에틸렌디옥시)디디(에틸 2-에틸부티레이트); 2-에틸부트릭산, 트리에틸렌 글리콜 디에스테르; 2-에틸부티르산, 트리에틸렌 글리콜이 함유된 디에스테르; 2-에틸부티르산, 트리에틸렌 글리콜 디에스테르; 4-02-00-00951 (Beilstein 핸드북 참조); 인공 지능3-01456; BRN 1804092; 부탄산, 2-에틸-, 1,2-에탄디일비스(옥시-2,1-에탄디일) 에스테르; 부티르산, 2-에틸-, 트리에틸렌 글리콜이 함유된 디에스테르; 플렉솔 가소제 3GH; HSDB 5285호; NSC 406329; 가소제 3GH; 트리 에틸렌 글리콜 비스 (2- 에틸 부티레이트); 트리 에틸렌 글리콜 디 (2- 에틸 부티레이트); 트리에틸렌 글리콜 디-2-에틸부티레이트; 트리 에틸렌 글리콜, 비스 (2- 에틸 부티레이트); 트리에틸렌글리콜 디에틸 부티레이트; 트리글리콜 디-(2-에틸부티레이트); 트리글리콜 디카프로에이트; 트리글리콜 디헥소에이트; 2,2'-에틸렌디옥시디에틸 비스(2-에틸부티레이트); 부탄산, 2-에틸-, 1,1'-(1,2-에탄디일비스(옥시-2,1-에탄디일)) 에스테르; 트리에틸렌 글리콜 디-(2-에틸부티레이트); 에탄 1,2- 디일 비스 (옥시 에탄 -2,1- 디일) 비스 (2- 에틸 부타 노 에이트); |
영문 이름 | 2,2'-ethylenedioxydiethyl bis(2-ethylbutyrate);Triethylene glycol bis(2-ethylbutyrate);2,2'-(Ethylenedioxy)di(ethyl 2-ethylbutyrate);2-Ethylbutric acid, triethylene glycol diester;2-Ethylbutyric acid, diester with triethylene glycol;2-Ethylbutyric acid, triethylene glycol diester;4-02-00-00951 (Beilstein Handbook Reference);AI3-01456;BRN 1804092;Butanoic acid, 2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester;Butyric acid, 2-ethyl-, diester with triethylene glycol;Flexol plasticizer 3GH;HSDB 5285;NSC 406329;Plasticizer 3GH;Triethylene glycol bis(2-ethyl butyrate);Triethylene glycol di(2-ethyl butyrate);Triethylene glycol di-2-ethylbutyrate;Triethylene glycol, bis(2-ethylbutyrate);Triethyleneglycol diethyl butyrate;Triglycol di-(2-ethylbutyrate);Triglycol dicaproate;Triglycol dihexoate;2,2'-Ethylenedioxydiethyl bis(2-ethylbutyrate);Butanoic acid, 2-ethyl-, 1,1'-(1,2-ethanediylbis(oxy-2,1-ethanediyl)) ester;Triethylene glycol di-(2-ethylbutyrate);ethane-1,2-diylbis(oxyethane-2,1-diyl) bis(2-ethylbutanoate) |
분자식 | C18H34O6 |
분자량 | 346.459 |
InChI | InChI=1/C18H34O6/c1-5-15(6-2)17(19)23-13-11-21-9-10-22-12-14-24-18(20)16(7-3)8-4/h15-16H,5-14H2,1-4H3 |
cas번호 | 95-08-9 |
EC번호 | 202-389-4 |
분자 구조 | ![]() |
밀도 | 1.001g/cm3 |
비등점 | 409°C at 760 mmHg |
굴절 지수 | 1.446 |
인화점 | 173.5°C |
증기압 | 6.69E-07mmHg at 25°C |
MSDS |