ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-96-2 2-Ethyl-1,3-hexanediol, mixture of isomers |
|
상품명칭 | 2-Ethyl-1,3-hexanediol, mixture of isomers |
영문 이름 | 2-Ethyl-1,3-hexanediol, mixture of isomers;Ethohexadiol;2-Ethylhexane-1,3-diol;octylene glycol;2-ethylhexane-1,1-diol;(2S,3S)-2-ethylhexane-1,3-diol;(2R,3S)-2-ethylhexane-1,3-diol;(2R,3R)-2-ethylhexane-1,3-diol;(2S,3R)-2-ethylhexane-1,3-diol;OG;2-Ethyl-1,3-Hexanediol |
분자식 | C8H18O2 |
분자량 | 146.2273 |
InChI | InChI=1/C8H18O2/c1-3-5-8(10)7(4-2)6-9/h7-10H,3-6H2,1-2H3/t7-,8+/m0/s1 |
cas번호 | 94-96-2 |
EC번호 | 202-377-9 |
분자 구조 | ![]() |
밀도 | 0.935g/cm3 |
녹는 점 | -40℃ |
비등점 | 243°C at 760 mmHg |
굴절 지수 | 1.45 |
인화점 | 129.4°C |
물 용해도 | 42 g/L (20℃) |
증기압 | 0.00558mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R41:; |
보안 규칙 | S25||S26||S39||S46:; |
MSDS |