trans-2-ethoxy-5-(1-propenyl)phenol |
|
상품명칭 | trans-2-ethoxy-5-(1-propenyl)phenol |
영문 이름 | trans-2-ethoxy-5-(1-propenyl)phenol;2-Ethoxy-5-prop-1-enylphenol;5-propenylguaethol;Vanitrope;2-ethoxy-5-(prop-1-en-1-yl)phenol;2-ethoxy-5-[(1E)-prop-1-en-1-yl]phenol;Propenyl guaethol |
분자식 | C11H14O2 |
분자량 | 178.2277 |
InChI | InChI=1/C11H14O2/c1-3-5-9-6-7-11(13-4-2)10(12)8-9/h3,5-8,12H,4H2,1-2H3/b5-3+ |
cas번호 | 94-86-0 |
EC번호 | 202-370-0 |
분자 구조 | |
밀도 | 1.052g/cm3 |
녹는 점 | 86-88℃ |
비등점 | 312.8°C at 760 mmHg |
굴절 지수 | 1.567 |
인화점 | 165.2°C |
증기압 | 0.000281mmHg at 25°C |
위험성 표시 | Xi##Irritant:; |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |