Chemindex > 94-46-2
KR ▼
isopentyl benzoate |
|
| 상품명칭 | isopentyl benzoate |
| 영문 이름 | isopentyl benzoate;Benzoic acid isoamyl ester;3-methyl-1-butanol benzoate;benzoic acid isopentyl ester;Isoamyl Benzoate;3-methylbutyl benzoate |
| 분자식 | C12H16O2 |
| 분자량 | 192.2542 |
| InChI | InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| cas번호 | 94-46-2 |
| EC번호 | 202-334-4 |
| 분자 구조 |  |
| 밀도 | 0.992g/cm3 |
| 비등점 | 260°C at 760 mmHg |
| 굴절 지수 | 1.495 |
| 인화점 | 109.4°C |
| 증기압 | 0.0125mmHg at 25°C |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.ChemNet Mall을 방문하여
isopentyl benzoate 94-46-2 의 가격에 대해 문의하십시오.
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 