ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
922-55-4 Lanthionine |
|
상품명칭 | Lanthionine |
영문 이름 | Lanthionine;lanthionine, mixture of dl and meso;di(2-amino-2-carboxyethyl) sulphide;S-[(2R)-2-amino-2-carboxyethyl]-D-cysteine;S-[(2R)-2-amino-2-carboxyethyl]-L-cysteine;(2S,2'S)-3,3'-sulfanediylbis(2-ammoniopropanoate) |
분자식 | C6H12N2O4S |
분자량 | 208.2355 |
InChI | InChI=1/C6H12N2O4S/c7-3(5(9)10)1-13-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m1/s1 |
cas번호 | 922-55-4 |
EC번호 | 213-076-7 |
분자 구조 | ![]() |
밀도 | 1.499g/cm3 |
녹는 점 | 280-283℃ |
비등점 | 462.6°C at 760 mmHg |
굴절 지수 | 1.606 |
인화점 | 233.5°C |
증기압 | 7.72E-10mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |