ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
921-53-9 L(+)tartaric acid dipotassium |
|
상품명칭 | L(+)tartaric acid dipotassium |
영문 이름 | L(+)tartaric acid dipotassium;dipotassium tartrate;L-Tartaric acid dipotassium salt;potassium tartrate |
분자식 | K2C4H4O6 |
분자량 | 226.266 |
InChI | InChI=1/C4H6O6.2K/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1 |
cas번호 | 921-53-9 |
EC번호 | 213-067-8 |
분자 구조 | |
밀도 | 1.98 |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |