ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
91-61-2 6-Methyl-1,2,3,4-tetrahydroquinoline |
|
상품명칭 | 6-Methyl-1,2,3,4-tetrahydroquinoline |
영문 이름 | 6-Methyl-1,2,3,4-tetrahydroquinoline;1,2,3,4-Tetrahydro-6-methylquinoline;AI3-36188;Civettal;NSC 65606;p-Methyltetrahydroquinoline;Quinoline, 1,2,3,4-tetrahydro-6-methyl- |
분자식 | C10H13N |
분자량 | 147.2169 |
InChI | InChI=1/C10H13N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h4-5,7,11H,2-3,6H2,1H3 |
cas번호 | 91-61-2 |
EC번호 | 202-083-0 |
분자 구조 | ![]() |
밀도 | 0.99g/cm3 |
비등점 | 264.2°C at 760 mmHg |
굴절 지수 | 1.539 |
인화점 | 119.1°C |
증기압 | 0.00982mmHg at 25°C |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
보안 규칙 | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |