ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
91-48-5 alpha-Phenylcinnamic acid |
|
상품명칭 | alpha-Phenylcinnamic acid |
영문 이름 | alpha-Phenylcinnamic acid;a-Phenyl-trans-cinnamic acid, Pract.;a-(Phenylmethylene)benzeneacetic acid, Pract.;Phenylcinnamicacid,98%;(2E)-2,3-diphenylprop-2-enoic acid;2,3-diphenylprop-2-enoic acid;(2Z)-2,3-diphenylprop-2-enoic acid;(2E)-2,3-diphenylprop-2-enoate;(2Z)-2,3-diphenylprop-2-enoate |
분자식 | C15H11O2 |
분자량 | 223.2472 |
InChI | InChI=1/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/p-1/b14-11- |
cas번호 | 91-48-5 |
EC번호 | 202-069-4 |
분자 구조 | ![]() |
녹는 점 | 171-175℃ |
비등점 | 336.6°C at 760 mmHg |
인화점 | 239.8°C |
증기압 | 4.35E-05mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |