이소풀레골 |
상품명칭 |
이소풀레골 |
별명 |
; 1- 메틸 -4- 이소 프로 페닐 시클로 헥산 -3- 올; p-멘트-8-en-3-올; (1R, 2S, 5R) -5- 메틸 -2- (소품 -1- 엔 -2- 일) 시클로 헥산올; |
영문 이름 |
Isopulegol;1-Methyl-4-isopropenylcyclohexan-3-ol;p-menth-8-en-3-ol;(1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
분자식 |
C10H18O |
분자량 |
154.2493 |
InChI |
InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
cas번호 |
89-79-2 |
EC번호 |
201-940-6 |
분자 구조 |
|
밀도 |
0.912g/cm3 |
비등점 |
197°C at 760 mmHg |
굴절 지수 |
1.472 |
인화점 |
78.3°C |
증기압 |
0.0993mmHg at 25°C |
위험성 표시 |
Xn##Harmful:;
|
리스크 규칙 |
R21/22##Harmful in contact with skin and if swallowed.:;
|
MSDS |
Material Safety Data Sheet |