ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-79-2 이소풀레골 |
|
상품명칭 | 이소풀레골 |
별명 | ; 1- 메틸 -4- 이소 프로 페닐 시클로 헥산 -3- 올; p-멘트-8-en-3-올; (1R, 2S, 5R) -5- 메틸 -2- (소품 -1- 엔 -2- 일) 시클로 헥산올; |
영문 이름 | Isopulegol;1-Methyl-4-isopropenylcyclohexan-3-ol;p-menth-8-en-3-ol;(1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
분자식 | C10H18O |
분자량 | 154.2493 |
InChI | InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
cas번호 | 89-79-2 |
EC번호 | 201-940-6 |
분자 구조 | |
밀도 | 0.912g/cm3 |
비등점 | 197°C at 760 mmHg |
굴절 지수 | 1.472 |
인화점 | 78.3°C |
증기압 | 0.0993mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R21/22##Harmful in contact with skin and if swallowed.:; |
MSDS |