ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-49-6 이소풀레길 아세테이트, 이성질체의 혼합물 |
|
상품명칭 | 이소풀레길 아세테이트, 이성질체의 혼합물 |
별명 | ;(1R, 2R, 5R) -5- 메틸 -2- (1- 메틸 에테닐) 시클로 헥실 아세테이트; (1R, 2R, 5S) -5- 메틸 -2- (1- 메틸 에테닐) 시클로 헥실 아세테이트; (1R, 2S, 5S) -5- 메틸 -2- (1- 메틸 에테닐) 시클로 헥실 아세테이트; |
영문 이름 | Isopulegyl acetate, mixture of isomers;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate |
분자식 | C12H20O2 |
분자량 | 196.286 |
InChI | InChI=1/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11-,12+/m0/s1 |
cas번호 | 89-49-6 |
분자 구조 | ![]() |
밀도 | 0.94g/cm3 |
비등점 | 248°C at 760 mmHg |
굴절 지수 | 1.458 |
인화점 | 85.6°C |
증기압 | 0.0248mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |