이소풀레길 아세테이트, 이성질체의 혼합물 |
상품명칭 |
이소풀레길 아세테이트, 이성질체의 혼합물 |
별명 |
;(1R, 2R, 5R) -5- 메틸 -2- (1- 메틸 에테닐) 시클로 헥실 아세테이트; (1R, 2R, 5S) -5- 메틸 -2- (1- 메틸 에테닐) 시클로 헥실 아세테이트; (1R, 2S, 5S) -5- 메틸 -2- (1- 메틸 에테닐) 시클로 헥실 아세테이트; |
영문 이름 |
Isopulegyl acetate, mixture of isomers;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate |
분자식 |
C12H20O2 |
분자량 |
196.286 |
InChI |
InChI=1/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11-,12+/m0/s1 |
cas번호 |
89-49-6 |
분자 구조 |
|
밀도 |
0.94g/cm3 |
비등점 |
248°C at 760 mmHg |
굴절 지수 |
1.458 |
인화점 |
85.6°C |
증기압 |
0.0248mmHg at 25°C |
보안 규칙 |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |