ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88196-70-7 (R)-1-(3-Methoxyphenyl)ethylamine |
|
상품명칭 | (R)-1-(3-Methoxyphenyl)ethylamine |
영문 이름 | (R)-1-(3-Methoxyphenyl)ethylamine;(R)-m-Methoxy-alpha-methylbenzylamine;(1R)-1-(3-methoxyphenyl)ethanamine |
분자식 | C9H13NO |
분자량 | 151.2056 |
InChI | InChI=1/C9H13NO/c1-7(10)8-4-3-5-9(6-8)11-2/h3-7H,10H2,1-2H3/t7-/m1/s1 |
cas번호 | 88196-70-7 |
분자 구조 | |
밀도 | 1.003g/cm3 |
비등점 | 234.6°C at 760 mmHg |
굴절 지수 | 1.522 |
인화점 | 94.7°C |
증기압 | 0.0524mmHg at 25°C |
리스크 규칙 | R21/22##Harmful in contact with skin and if swallowed.||R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |