ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-97-1 phthalamic acid |
|
상품명칭 | phthalamic acid |
영문 이름 | phthalamic acid;Phthalamic acid, (2-Carboxybenzamide);2-Carboxybenzamide;2-carbamoylbenzoic acid |
분자식 | C8H7NO3 |
분자량 | 165.1461 |
InChI | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
cas번호 | 88-97-1 |
EC번호 | 201-871-1 |
분자 구조 | ![]() |
밀도 | 1.368g/cm3 |
비등점 | 394.2°C at 760 mmHg |
굴절 지수 | 1.615 |
인화점 | 192.2°C |
증기압 | 6.38E-07mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |