Chemindex > 88-97-1
KR ▼
phthalamic acid |
|
| 상품명칭 | phthalamic acid |
| 영문 이름 | phthalamic acid;Phthalamic acid, (2-Carboxybenzamide);2-Carboxybenzamide;2-carbamoylbenzoic acid |
| 분자식 | C8H7NO3 |
| 분자량 | 165.1461 |
| InChI | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| cas번호 | 88-97-1 |
| EC번호 | 201-871-1 |
| 분자 구조 |  |
| 밀도 | 1.368g/cm3 |
| 비등점 | 394.2°C at 760 mmHg |
| 굴절 지수 | 1.615 |
| 인화점 | 192.2°C |
| 증기압 | 6.38E-07mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
88-97-1 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 