Chemindex > 88-86-8
KR ▼
2,5-dichloro-3-nitrobenzoic acid |
|
| 상품명칭 | 2,5-dichloro-3-nitrobenzoic acid |
| 영문 이름 | 2,5-dichloro-3-nitrobenzoic acid;Benzoic acid, 2,5-dichloro-3-nitro-;2,5-Dichloro-3-nitrobenzoic acid;2,5-Dichloro-4-nitrobenzoic acid;2-09-00-00276 (Beilstein Handbook Reference);3-Nitro-2,5-dichlorobenzoic acid;BRN 1976119;Caswell No. 312;Dinoben;EPA Pesticide Chemical Code 028101;Kyselina 2,5-dichlor-3-nitrobenzoova;Kyselina 2,5-dichlor-3-nitrobenzoova [Czech] |
| 분자식 | C7H3Cl2NO4 |
| 분자량 | 236.009 |
| InChI | InChI=1/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
| cas번호 | 88-86-8 |
| EC번호 | 201-862-2 |
| 분자 구조 |  |
| 밀도 | 1.713g/cm3 |
| 녹는 점 | 216-220℃ |
| 비등점 | 366.5°C at 760 mmHg |
| 굴절 지수 | 1.638 |
| 인화점 | 175.5°C |
| 증기압 | 5.11E-06mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 