ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-64-9 2-Chloro-6-methylphenol |
|
상품명칭 | 2-Chloro-6-methylphenol |
영문 이름 | 2-Chloro-6-methylphenol;2-Chloro-6-methylphenol,98%;6-Chloro-o-cresol (OH=1);6-Chloro-o-cresol |
분자식 | C7H7ClO |
분자량 | 142.5829 |
InChI | InChI=1/C7H7ClO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,1H3 |
cas번호 | 87-64-9 |
EC번호 | 201-760-8 |
분자 구조 | |
밀도 | 1.228g/cm3 |
비등점 | 200.4°C at 760 mmHg |
굴절 지수 | 1.565 |
인화점 | 75°C |
증기압 | 0.229mmHg at 25°C |
리스크 규칙 | R21/22##Harmful in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |