cinnamyl anthranilate |
|
상품명칭 | cinnamyl anthranilate |
영문 이름 | cinnamyl anthranilate;2-Aminobenzoic acid cinnamyl ester~Cinnamyl anthranilate;3-phenylprop-2-en-1-yl 2-aminobenzoate;(2E)-3-phenylprop-2-en-1-yl 2-aminobenzoate |
분자식 | C16H15NO2 |
분자량 | 253.2958 |
InChI | InChI=1/C16H15NO2/c17-15-11-5-4-10-14(15)16(18)19-12-6-9-13-7-2-1-3-8-13/h1-11H,12,17H2/b9-6+ |
cas번호 | 87-29-6 |
EC번호 | 201-738-8 |
분자 구조 | |
밀도 | 1.178g/cm3 |
비등점 | 449.1°C at 760 mmHg |
굴절 지수 | 1.642 |
인화점 | 269.4°C |
증기압 | 2.95E-08mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |