ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-26-0 2-Methoxybiphenyl |
|
상품명칭 | 2-Methoxybiphenyl |
영문 이름 | 2-Methoxybiphenyl;2-Phenylanisole;biphenyl-2-yl methyl ether;o-Methoxybiphenyl |
분자식 | C13H12O |
분자량 | 184.2338 |
InChI | InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
cas번호 | 86-26-0 |
EC번호 | 201-659-9 |
분자 구조 | ![]() |
밀도 | 1.03g/cm3 |
녹는 점 | 30-33℃ |
비등점 | 274°C at 760 mmHg |
굴절 지수 | 1.556 |
인화점 | 101.3°C |
증기압 | 0.00928mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R33##Danger of cummulative effects.:; |
보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |