Chemindex > 86-26-0
KR ▼
86-26-0 2-Methoxybiphenyl |
|
| 상품명칭 | 2-Methoxybiphenyl |
| 영문 이름 | 2-Methoxybiphenyl;2-Phenylanisole;biphenyl-2-yl methyl ether;o-Methoxybiphenyl |
| 분자식 | C13H12O |
| 분자량 | 184.2338 |
| InChI | InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| cas번호 | 86-26-0 |
| EC번호 | 201-659-9 |
| 분자 구조 |  |
| 밀도 | 1.03g/cm3 |
| 녹는 점 | 30-33℃ |
| 비등점 | 274°C at 760 mmHg |
| 굴절 지수 | 1.556 |
| 인화점 | 101.3°C |
| 증기압 | 0.00928mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R33##Danger of cummulative effects.:; |
| 보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 