ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-81-4 6-Methoxy-8-nitroquinoline |
|
상품명칭 | 6-Methoxy-8-nitroquinoline |
영문 이름 | 6-Methoxy-8-nitroquinoline;6-Methoxy-8-Nitro quinoline;methyl 8-nitro-6-quinolyl ether;6-Metoxy-8-nitroquinoline, 99% |
분자식 | C10H8N2O3 |
분자량 | 204.1821 |
InChI | InChI=1/C10H8N2O3/c1-15-8-5-7-3-2-4-11-10(7)9(6-8)12(13)14/h2-6H,1H3 |
cas번호 | 85-81-4 |
EC번호 | 201-633-7 |
분자 구조 | |
밀도 | 1.337g/cm3 |
녹는 점 | 158-162℃ |
비등점 | 373.1°C at 760 mmHg |
굴절 지수 | 1.646 |
인화점 | 179.4°C |
증기압 | 1.97E-05mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |