Chemindex > 85-02-9
KR ▼
85-02-9 5,6-Benzoquinoline |
|
| 상품명칭 | 5,6-Benzoquinoline |
| 영문 이름 | 5,6-Benzoquinoline;beta-Naphthoquinoline;1-Azaphenanthrene;Benzo[f]quinoline;Benzoquinoline;benzo(f)quinoline |
| 분자식 | C13H9N |
| 분자량 | 179.2173 |
| InChI | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
| cas번호 | 85-02-9 |
| EC번호 | 201-582-0 |
| 분자 구조 |  |
| 밀도 | 1.187g/cm3 |
| 녹는 점 | 89-91℃ |
| 비등점 | 350.4°C at 760 mmHg |
| 굴절 지수 | 1.726 |
| 인화점 | 155.9°C |
| 증기압 | 8.89E-05mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 