ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84434-04-8 2-아미노에탄올, 1H-벤조트리아졸과 화합물 |
|
상품명칭 | 2-아미노에탄올, 1H-벤조트리아졸과 화합물 |
별명 | 2-아미노에탄올, 1H-벤조트리아졸과 화합물; 2- 아미노 에탄올 - 1H- 벤조 트리아 졸 (1 : 1); |
영문 이름 | 2-aminoethanol, compound with 1H-benzotriazole;2-Aminoethanol, compound with 1H-benzotriazole;2-aminoethanol - 1H-benzotriazole (1:1) |
분자식 | C8H12N4O |
분자량 | 180.2071 |
InChI | InChI=1/C6H5N3.C2H7NO/c1-2-4-6-5(3-1)7-9-8-6;3-1-2-4/h1-4H,(H,7,8,9);4H,1-3H2 |
cas번호 | 84434-04-8 |
EC번호 | 282-802-2 |
분자 구조 | |
비등점 | 496.3°C at 760 mmHg |
인화점 | 254°C |
증기압 | 1.14E-10mmHg at 25°C |
MSDS |