2,6-Dihydroxyanthraquinone |
|
상품명칭 | 2,6-Dihydroxyanthraquinone |
영문 이름 | 2,6-Dihydroxyanthraquinone; |
분자식 | C14H8O4 |
분자량 | 240.2109 |
InChI | InChI=1/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
cas번호 | 84-60-6 |
EC번호 | 201-544-3 |
분자 구조 | |
밀도 | 1.54g/cm3 |
녹는 점 | 320℃ |
비등점 | 442.1°C at 760 mmHg |
굴절 지수 | 1.732 |
인화점 | 235.3°C |
증기압 | 1.99E-08mmHg at 25°C |
위험성 표시 | Xi##Irritant:; |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |