ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-24-9 2,5-Dimethyl-1-phenylpyrrole |
|
상품명칭 | 2,5-Dimethyl-1-phenylpyrrole |
영문 이름 | 2,5-Dimethyl-1-phenylpyrrole;1H-Pyrrole, 2,5-dimethyl-1-phenyl-;NSC 163170;2,5-Dimethyl-1-phenyl-1H-pyrrole;Pyrrole, 2,5-dimethyl-1-phenyl- (8CI);1-cyclohexyl-2,5-dimethyl-1H-pyrrole;2,5-dimethyl-1-phenylpyrrolidine |
분자식 | C12H17N |
분자량 | 175.2701 |
InChI | InChI=1/C12H17N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
cas번호 | 83-24-9 |
EC번호 | 201-461-2 |
분자 구조 | |
밀도 | 0.952g/cm3 |
녹는 점 | 50-51℃ |
비등점 | 257.7°C at 760 mmHg |
굴절 지수 | 1.519 |
인화점 | 100.2°C |
증기압 | 0.0143mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |