ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82769-76-4 (S)-3-Amino-3-phenylpropan-1-ol |
|
상품명칭 | (S)-3-Amino-3-phenylpropan-1-ol |
영문 이름 | (S)-3-Amino-3-phenylpropan-1-ol;(S)-1-Phenyl-3-propanolamine;(S)-3-Amino-3-phenylpropi-1-ol;(S)-3-Amino-3-phenylpropan-l-ol;(3S)-3-amino-3-phenyl-propan-1-ol hydrochloride |
분자식 | C9H14ClNO |
분자량 | 187.6666 |
InChI | InChI=1/C9H13NO.ClH/c10-9(6-7-11)8-4-2-1-3-5-8;/h1-5,9,11H,6-7,10H2;1H/t9-;/m0./s1 |
cas번호 | 82769-76-4 |
분자 구조 | |
비등점 | 325.3°C at 760 mmHg |
인화점 | 150.5°C |
증기압 | 9.47E-05mmHg at 25°C |
위험성 표시 | C##Corrosive:; |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |