ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 825-52-5 2-hydroxyimino-2-phenylacetonitrile, mixture | |
| 상품명칭 | 2-hydroxyimino-2-phenylacetonitrile, mixture | 
| 영문 이름 | 2-hydroxyimino-2-phenylacetonitrile, mixture;2-Hydroxyimino-2-phenylacetonitrile;Benzoyl cyanide oxime~Phenylglyoxylonitrile oxime;(hydroxyimino)(phenyl)acetonitrile;(2E)-(hydroxyimino)(phenyl)ethanenitrile | 
| 분자식 | C8H6N2O | 
| 분자량 | 146.146 | 
| InChI | InChI=1/C8H6N2O/c9-6-8(10-11)7-4-2-1-3-5-7/h1-5,11H/b10-8- | 
| cas번호 | 825-52-5 | 
| EC번호 | 212-546-9 | 
| 분자 구조 |  | 
| 밀도 | 1.11g/cm3 | 
| 녹는 점 | 128-130℃ | 
| 비등점 | 293.3°C at 760 mmHg | 
| 굴절 지수 | 1.562 | 
| 인화점 | 131.2°C | 
| 증기압 | 0.000793mmHg at 25°C | 
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; | 
| 보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; | 
| MSDS | |