Chemindex > 824-62-4
KR ▼
824-62-4 Bicyclo[2.2.1]heptane-2-carboxylic Acid |
|
| 상품명칭 | Bicyclo[2.2.1]heptane-2-carboxylic Acid |
| 영문 이름 | Bicyclo[2.2.1]heptane-2-carboxylic Acid;Norbornane-2-carboxylic acid;(1R,2S,4S)-bicyclo[2.2.1]heptane-2-carboxylate;(1S,2S,4R)-bicyclo[2.2.1]heptane-2-carboxylate |
| 분자식 | C8H11O2 |
| 분자량 | 139.1723 |
| InChI | InChI=1/C8H12O2/c9-8(10)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2,(H,9,10)/p-1/t5-,6+,7+/m1/s1 |
| cas번호 | 824-62-4 |
| EC번호 | 212-532-2 |
| 분자 구조 | ![824-62-4 Bicyclo[2.2.1]heptane-2-carboxylic Acid](https://images-a.chemnet.com/suppliers/chembase/cas/cas824-62-4.gif "824-62-4 Bicyclo[2.2.1]heptane-2-carboxylic Acid") |
| 비등점 | 247.822°C at 760 mmHg |
| 인화점 | 113.81°C |
| 증기압 | 0.008mmHg at 25°C |
| 리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 