ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-22-4 1,1'-디안트리마이드 |
|
상품명칭 | 1,1'-디안트리마이드 |
별명 | ; 1,1-이미노디안트라퀴논; 1,1'-이미노디안트라센-9,10-디온; |
영문 이름 | 1,1'-dianthrimide;1,1-iminodianthraquinone;1,1'-iminodianthracene-9,10-dione |
분자식 | C28H15NO4 |
분자량 | 429.423 |
InChI | InChI=1/C28H15NO4/c30-25-15-7-1-3-9-17(15)27(32)23-19(25)11-5-13-21(23)29-22-14-6-12-20-24(22)28(33)18-10-4-2-8-16(18)26(20)31/h1-14,29H |
cas번호 | 82-22-4 |
EC번호 | 201-405-7 |
분자 구조 | ![]() |
밀도 | 1.456g/cm3 |
녹는 점 | 300℃ |
비등점 | 667.1°C at 760 mmHg |
굴절 지수 | 1.753 |
인화점 | 221.6°C |
증기압 | 1.17E-17mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |