ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
815-82-7 Cupric Tartrate |
|
상품명칭 | Cupric Tartrate |
영문 이름 | Cupric Tartrate;Copper(II) tartrate hydrate;Coppertartratehydratebluegreenxtl;Tartaric acid cupric salt;copper(2+) (2R,3R)-2,3-dihydroxybutanedioate |
분자식 | C4H4CuO6 |
분자량 | 211.617 |
InChI | InChI=1/C4H6O6.Cu/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2/t1-,2-;/m1./s1 |
cas번호 | 815-82-7;17263-56-8 |
EC번호 | 212-425-0 |
분자 구조 | ![]() |
비등점 | 399.3°C at 760 mmHg |
인화점 | 209.4°C |
물 용해도 | slightly soluble |
증기압 | 4.93E-08mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |