ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
815-68-9 Triacetylmethane |
|
상품명칭 | Triacetylmethane |
영문 이름 | Triacetylmethane;methine triacetate;3-acetylpentane-2,4-dione;3-(1-hydroxyethylidene)pentane-2,4-dione |
분자식 | C7H10O3 |
분자량 | 142.1525 |
InChI | InChI=1/C7H10O3/c1-4(8)7(5(2)9)6(3)10/h8H,1-3H3 |
cas번호 | 815-68-9 |
EC번호 | 212-422-4 |
분자 구조 | ![]() |
밀도 | 1.101g/cm3 |
비등점 | 298.3°C at 760 mmHg |
굴절 지수 | 1.467 |
인화점 | 148.4°C |
증기압 | 0.000129mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |