ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
79-35-6 1,1-dichloro-2,2-difluoroethylene |
|
상품명칭 | 1,1-dichloro-2,2-difluoroethylene |
영문 이름 | 1,1-dichloro-2,2-difluoroethylene;FC-1112a;1-chloro-1,2,2-trifluoroethene |
분자식 | C2Cl2F2 |
분자량 | 132.9242 |
InChI | InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
cas번호 | 79-35-6 |
EC번호 | 201-198-3 |
분자 구조 | ![]() |
밀도 | 1.503g/cm3 |
비등점 | 17.3°C at 760 mmHg |
굴절 지수 | 1.392 |
증기압 | 999mmHg at 25°C |
리스크 규칙 | R23##Toxic by inhalation.||R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S9##Keep container in a well-ventilated place.:; |
MSDS |