ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-73-6 Dicyclopentadiene |
|
상품명칭 | Dicyclopentadiene |
영문 이름 | Dicyclopentadiene;3a,4,7,7a-Tetrahydro-4,7-methanoindene;Cyclopentadiene dimer~3a,4,7,7a-Tetrahydro-4,7-methanoindene;DCPD;dicyclopentadiene (stabilized with bht);Dicyclopentadiene (>95%);Dicyclopentadiene (70%);Dicyopentadiene;Dicyclopentadiene (80%);Dicyclopentadiene dimer |
분자식 | C10H12 |
분자량 | 132.2 |
InChI | InChI=1/C10H12/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,4-5,7-10H,3,6H2 |
cas번호 | 77-73-6 |
EC번호 | 201-052-9 |
분자 구조 | |
밀도 | 0.982 |
녹는 점 | -1℃ |
비등점 | 170℃ |
굴절 지수 | 1.51-1.512 |
인화점 | 26℃ |
위험성 표시 | F##Flammable||Xn##Harmful||N##Dangerous for the environment:; |
리스크 규칙 | R11||R20/22||R36/37/38||R51/53:; |
보안 규칙 | S36/37||S61:; |
MSDS |