ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-62-3 Methylenebismethylcyclohexylpcresol; 90% |
|
상품명칭 | Methylenebismethylcyclohexylpcresol; 90% |
영문 이름 | Methylenebismethylcyclohexylpcresol; 90%;Bis[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methane;2,2-methylenebis(6-cyclohexyl-4-methylphenol);2,2-Methylenebis[6-(1-methylcyclohexyl)-p-cresol];2,2'-methanediylbis[4-methyl-6-(1-methylcyclohexyl)phenol] |
분자식 | C29H40O2 |
분자량 | 420.6267 |
InChI | InChI=1/C29H40O2/c1-20-15-22(26(30)24(17-20)28(3)11-7-5-8-12-28)19-23-16-21(2)18-25(27(23)31)29(4)13-9-6-10-14-29/h15-18,30-31H,5-14,19H2,1-4H3 |
cas번호 | 77-62-3 |
EC번호 | 201-044-5 |
분자 구조 | ![]() |
밀도 | 1.058g/cm3 |
비등점 | 526.9°C at 760 mmHg |
굴절 지수 | 1.567 |
인화점 | 219.2°C |
증기압 | 1.02E-11mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |