Methylenebismethylcyclohexylpcresol; 90% |
상품명칭 |
Methylenebismethylcyclohexylpcresol; 90% |
영문 이름 |
Methylenebismethylcyclohexylpcresol; 90%;Bis[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methane;2,2-methylenebis(6-cyclohexyl-4-methylphenol);2,2-Methylenebis[6-(1-methylcyclohexyl)-p-cresol];2,2'-methanediylbis[4-methyl-6-(1-methylcyclohexyl)phenol] |
분자식 |
C29H40O2 |
분자량 |
420.6267 |
InChI |
InChI=1/C29H40O2/c1-20-15-22(26(30)24(17-20)28(3)11-7-5-8-12-28)19-23-16-21(2)18-25(27(23)31)29(4)13-9-6-10-14-29/h15-18,30-31H,5-14,19H2,1-4H3 |
cas번호 |
77-62-3 |
EC번호 |
201-044-5 |
분자 구조 |
|
밀도 |
1.058g/cm3 |
비등점 |
526.9°C at 760 mmHg |
굴절 지수 |
1.567 |
인화점 |
219.2°C |
증기압 |
1.02E-11mmHg at 25°C |
보안 규칙 |
S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |