ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-61-2 2,4- 디메틸 -6- (1- 메틸 시클로 헥실) 페놀 |
|
상품명칭 | 2,4- 디메틸 -6- (1- 메틸 시클로 헥실) 페놀 |
별명 | ; 로위녹스(rg WSL; 6-(1-메틸시클로헥실)-2,4-자일레놀; |
영문 이름 | 2,4-Dimethyl-6-(1-methylcyclohexyl)phenol;Lowinox(rg WSL;6-(1-Methylcyclohexyl)-2,4-xylenol |
분자식 | C15H22O |
분자량 | 218.3346 |
InChI | InChI=1/C15H22O/c1-11-9-12(2)14(16)13(10-11)15(3)7-5-4-6-8-15/h9-10,16H,4-8H2,1-3H3 |
cas번호 | 77-61-2 |
EC번호 | 201-042-4 |
분자 구조 | ![]() |
밀도 | 0.992g/cm3 |
비등점 | 311°C at 760 mmHg |
굴절 지수 | 1.532 |
인화점 | 140°C |
증기압 | 0.000317mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.||R43##May cause sensitization by skin contact.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |