Chemindex > 77-04-3
KR ▼
77-04-3 Pyrithyldione |
|
| 상품명칭 | Pyrithyldione |
| 영문 이름 | Pyrithyldione;3,3-Diethyl-2,4(1H,3H)-pyridinedione;3,3-diethylpyridine-2,4(1H,3H)-dione |
| 분자식 | C9H13NO2 |
| 분자량 | 167.205 |
| InChI | InChI=1/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
| cas번호 | 77-04-3 |
| EC번호 | 201-000-5 |
| 분자 구조 |  |
| 밀도 | 1.029g/cm3 |
| 비등점 | 330.2°C at 760 mmHg |
| 굴절 지수 | 1.464 |
| 인화점 | 147.8°C |
| 증기압 | 0.000169mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R20/21##Harmful by inhalation and in contact with skin.:; |
| 보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 