7623-11-2 2-Chlorobutyryl chloride |
|
상품명칭 | 2-Chlorobutyryl chloride |
영문 이름 | 2-Chlorobutyryl chloride;2-Chlorobutyryl chloride;2-chlorobutanoyl chloride |
분자식 | C4H6Cl2O |
분자량 | 140.9958 |
InChI | InChI=1/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
cas번호 | 7623-11-2 |
분자 구조 | |
밀도 | 1.227g/cm3 |
비등점 | 130.5°C at 760 mmHg |
굴절 지수 | 1.44 |
인화점 | 53.2°C |
증기압 | 9.68mmHg at 25°C |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall