7623-11-2 2-Chlorobutyryl chloride |
|
Nama produk | 2-Chlorobutyryl chloride |
Nama bahasa Inggris | 2-Chlorobutyryl chloride;2-Chlorobutyryl chloride;2-chlorobutanoyl chloride |
MF | C4H6Cl2O |
Berat Molekul | 140.9958 |
InChI | InChI=1/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
CAS NO | 7623-11-2 |
Struktur Molekul | |
Kepadatan | 1.227g/cm3 |
Titik didih | 130.5°C at 760 mmHg |
Indeks bias | 1.44 |
Titik nyala | 53.2°C |
Tekanan uap | 9.68mmHg at 25°C |
Kode Risiko | R34##Causes burns.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |
- Jika Anda berencana untuk mendapatkan 2-Chlorobutyryl chloride 7623-11-2 dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall