Chemindex > 75-27-4
KR ▼
Bromodichloromethane |
|
| 상품명칭 | Bromodichloromethane |
| 영문 이름 | Bromodichloromethane;FC-20B1 |
| 분자식 | CHBrCl2 |
| 분자량 | 163.8286 |
| InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
| cas번호 | 75-27-4 |
| EC번호 | 200-856-7 |
| 분자 구조 |  |
| 밀도 | 2.013g/cm3 |
| 녹는 점 | -55℃ |
| 비등점 | 89.7°C at 760 mmHg |
| 굴절 지수 | 1.503 |
| 인화점 | 1.3°C |
| 증기압 | 65.3mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
| 보안 규칙 | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 