ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
720-75-2 Methyl 4-biphenylcarboxylate |
|
상품명칭 | Methyl 4-biphenylcarboxylate |
영문 이름 | Methyl 4-biphenylcarboxylate;P-phenylbenzoic acid methyl ester;p-Phenylbenzoic acid-OMe;Methyl 4-Phenylbenzoate;4-Biphenylcarboxylic acid methyl ester~Methyl 4-phenylbenzoate;methyl biphenyl-4-carboxylate;methyl 4-phenylcyclohexanecarboxylate |
분자식 | C14H18O2 |
분자량 | 218.2915 |
InChI | InChI=1/C14H18O2/c1-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
cas번호 | 720-75-2 |
EC번호 | 211-954-4 |
분자 구조 | ![]() |
밀도 | 1.048g/cm3 |
녹는 점 | 118℃ |
비등점 | 307.8°C at 760 mmHg |
굴절 지수 | 1.517 |
인화점 | 132.7°C |
증기압 | 0.000709mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |