ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
|
상품명칭 | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
영문 이름 | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
분자식 | C14H8Cl4 |
분자량 | 318.02 |
InChI | InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
cas번호 | 72-55-9 |
EC번호 | 200-784-6 |
분자 구조 | ![]() |
녹는 점 | 87-90℃ |
물 용해도 | 0.00000013 g/100 mL |
위험성 표시 | |
리스크 규칙 | R22##Harmful if swallowed.||R33##Danger of cummulative effects.:; |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |