ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
719-60-8 Pentafluorocinnamic acid |
|
상품명칭 | Pentafluorocinnamic acid |
영문 이름 | Pentafluorocinnamic acid;2,3,4,5,6-Pentafluorocinnamic acid;(2E)-3-(pentafluorophenyl)prop-2-enoate;(2E)-3-(pentafluorophenyl)prop-2-enoic acid;3-(pentafluorophenyl)prop-2-enoate |
분자식 | C9H2F5O2 |
분자량 | 237.1035 |
InChI | InChI=1/C9H3F5O2/c10-5-3(1-2-4(15)16)6(11)8(13)9(14)7(5)12/h1-2H,(H,15,16)/p-1 |
cas번호 | 719-60-8 |
분자 구조 | |
녹는 점 | 152-156℃ |
비등점 | 251.5°C at 760 mmHg |
인화점 | 105.9°C |
증기압 | 0.0106mmHg at 25°C |
위험성 표시 | Xi##Irritant:; |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |