ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
717-27-1 Methylhydroquinone diacetate |
|
상품명칭 | Methylhydroquinone diacetate |
영문 이름 | Methylhydroquinone diacetate;2,5-Diacetoxytoluene;2-methylbenzene-1,4-diyl diacetate |
분자식 | C11H12O4 |
분자량 | 208.2106 |
InChI | InChI=1/C11H12O4/c1-7-6-10(14-8(2)12)4-5-11(7)15-9(3)13/h4-6H,1-3H3 |
cas번호 | 717-27-1 |
분자 구조 | ![]() |
밀도 | 1.15g/cm3 |
비등점 | 289.7°C at 760 mmHg |
굴절 지수 | 1.505 |
인화점 | 140.2°C |
증기압 | 0.00217mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |