Chemindex > 716-53-0
KR ▼
716-53-0 9-chloroanthracene |
|
| 상품명칭 | 9-chloroanthracene |
| 영문 이름 | 9-chloroanthracene;Anthracene, 9-chloro-;9-Chloroanthracene;CCRIS 5547 |
| 분자식 | C14H9Cl |
| 분자량 | 212.6743 |
| InChI | InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| cas번호 | 716-53-0 |
| EC번호 | 211-937-1 |
| 분자 구조 |  |
| 밀도 | 1.253g/cm3 |
| 녹는 점 | 103-103℃ |
| 비등점 | 370.1°C at 760 mmHg |
| 굴절 지수 | 1.717 |
| 인화점 | 179.2°C |
| 증기압 | 2.42E-05mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 