Chemindex > 715-33-3
KR ▼
715-33-3 Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
|
| 상품명칭 | Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
| 영문 이름 | Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate;3,5-Dibromo-2,4-dihydroxy-6-methylbenzoic acid methyl ester |
| 분자식 | C9H8Br2O4 |
| 분자량 | 339.9654 |
| InChI | InChI=1/C9H8Br2O4/c1-3-4(9(14)15-2)7(12)6(11)8(13)5(3)10/h12-13H,1-2H3 |
| cas번호 | 715-33-3 |
| 분자 구조 |  |
| 밀도 | 1.967g/cm3 |
| 비등점 | 307.4°C at 760 mmHg |
| 굴절 지수 | 1.636 |
| 인화점 | 139.7°C |
| 증기압 | 0.0004mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
715-33-3 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 