ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
711-79-5 2-Acetyl-1-naphthol |
|
상품명칭 | 2-Acetyl-1-naphthol |
영문 이름 | 2-Acetyl-1-naphthol;1-Hydroxy-2-acetonaphthone;2-Acetyl-1-hydroxynaphthalene |
분자식 | C12H10O2 |
분자량 | 186.2066 |
InChI | InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
cas번호 | 711-79-5 |
EC번호 | 211-918-8 |
분자 구조 | ![]() |
밀도 | 1.213g/cm3 |
녹는 점 | 97-100℃ |
비등점 | 334.9°C at 760 mmHg |
굴절 지수 | 1.65 |
인화점 | 142.4°C |
증기압 | 6.37E-05mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |