ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
704-38-1 Bis(2-thienyl) ketone |
|
상품명칭 | Bis(2-thienyl) ketone |
영문 이름 | Bis(2-thienyl) ketone;Di-2-thienyl ketone;Bis(2-thienyl)ketone~Di-2-thienyl ketone;dithiophen-2-ylmethanone |
분자식 | C9H6OS2 |
분자량 | 194.2733 |
InChI | InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
cas번호 | 704-38-1 |
분자 구조 | |
밀도 | 1.326g/cm3 |
녹는 점 | 89-91℃ |
비등점 | 323°C at 760 mmHg |
굴절 지수 | 1.64 |
인화점 | 149.1°C |
증기압 | 0.00027mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |