ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
703-23-1 2-Hydroxy-6-methoxyacetophenone |
|
상품명칭 | 2-Hydroxy-6-methoxyacetophenone |
영문 이름 | 2-Hydroxy-6-methoxyacetophenone;1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one;1-(2-hydroxy-6-methoxyphenyl)ethanone;2'-Hydroxy-6'-methoxyacetophenone |
분자식 | C9H10O3 |
분자량 | 166.1739 |
InChI | InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
cas번호 | 703-23-1 |
EC번호 | 211-872-9 |
분자 구조 | |
밀도 | 1.158g/cm3 |
녹는 점 | 58-60℃ |
비등점 | 259.5°C at 760 mmHg |
굴절 지수 | 1.537 |
인화점 | 108.1°C |
증기압 | 0.00798mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |