ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
701-70-2 Alpha-Ethylphenethyl alcohol |
|
상품명칭 | Alpha-Ethylphenethyl alcohol |
영문 이름 | Alpha-Ethylphenethyl alcohol;1-Phenyl-2-butanol;1-phenylbutan-2-ol;(2S)-1-phenylbutan-2-ol;(2R)-1-phenylbutan-2-ol |
분자식 | C10H14O |
분자량 | 150.2176 |
InChI | InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
cas번호 | 701-70-2 |
EC번호 | 211-858-2 |
분자 구조 | |
밀도 | 0.98g/cm3 |
비등점 | 226.6°C at 760 mmHg |
굴절 지수 | 1.52 |
인화점 | 100°C |
증기압 | 0.0459mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |