ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70-57-5 5-Methylnicotinamide |
|
상품명칭 | 5-Methylnicotinamide |
영문 이름 | 5-Methylnicotinamide;5-Methylpyridine-3-carboxamide |
분자식 | C7H8N2O |
분자량 | 136.1512 |
InChI | InChI=1/C7H8N2O/c1-5-2-6(7(8)10)4-9-3-5/h2-4H,1H3,(H2,8,10) |
cas번호 | 70-57-5 |
분자 구조 | ![]() |
밀도 | 1.157g/cm3 |
비등점 | 290°C at 760 mmHg |
굴절 지수 | 1.561 |
인화점 | 129.2°C |
증기압 | 0.00213mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |