Chemindex > 65858-51-7
KR ▼
65858-51-7 5-(bromomethyl)-6-chloro-2,1,3-benzothiadiazole |
|
| 상품명칭 | 5-(bromomethyl)-6-chloro-2,1,3-benzothiadiazole |
| 영문 이름 | 5-(bromomethyl)-6-chloro-2,1,3-benzothiadiazole; |
| 분자식 | C7H4BrClN2S |
| 분자량 | 263.5421 |
| InChI | InChI=1/C7H4BrClN2S/c8-3-4-1-6-7(2-5(4)9)11-12-10-6/h1-2H,3H2 |
| cas번호 | 65858-51-7 |
| 분자 구조 |  |
| 밀도 | 1.87g/cm3 |
| 녹는 점 | 75℃ |
| 비등점 | 331.2°C at 760 mmHg |
| 굴절 지수 | 1.729 |
| 인화점 | 154.1°C |
| 증기압 | 0.000304mmHg at 25°C |
| 위험성 표시 |  C##Corrosive:; |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
65858-51-7 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 