Chemindex > 64-65-3
KR ▼
Bemegride |
|
| 상품명칭 | Bemegride |
| 영문 이름 | Bemegride;3-Ethyl-3-methylglutarimide;4-Ethyl-4-methyl-2,6-piperidinedione;3-Methyl-3-ethylglutarimide;4-ethyl-4-methylpiperidine-2,6-dione |
| 분자식 | C8H13NO2 |
| 분자량 | 155.1943 |
| InChI | InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
| cas번호 | 64-65-3 |
| EC번호 | 200-588-0 |
| 분자 구조 |  |
| 밀도 | 1.024g/cm3 |
| 녹는 점 | 126-129℃ |
| 비등점 | 282°C at 760 mmHg |
| 굴절 지수 | 1.448 |
| 인화점 | 125.8°C |
| 증기압 | 0.00344mmHg at 25°C |
| 위험성 표시 |  T##Toxic:; |
| 리스크 규칙 | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
64-65-3 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 