ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
637-39-8 Triethanolamine hydrochloride |
|
상품명칭 | Triethanolamine hydrochloride |
영문 이름 | Triethanolamine hydrochloride;2,2,2-Nitrilotriethanol hydrochloride~Tris(2-hydroxyethyl)amine hydrochloride;triethanolamine hcl;tris(2-hydroxyethyl)ammonium chloride;2,2',2''-nitrilotriethanol hydrochloride (1:1) |
분자식 | C6H16ClNO3 |
분자량 | 185.6491 |
InChI | InChI=1/C6H15NO3.ClH/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;1H |
cas번호 | 637-39-8 |
EC번호 | 211-284-2 |
분자 구조 | |
녹는 점 | 177-179℃ |
비등점 | 335.4°C at 760 mmHg |
인화점 | 185°C |
증기압 | 8.38E-06mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |