ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-32-6 Benzoyl bromide |
|
상품명칭 | Benzoyl bromide |
영문 이름 | Benzoyl bromide; |
분자식 | C7H5BrO |
분자량 | 185.018 |
InChI | InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
cas번호 | 618-32-6 |
EC번호 | 210-544-2 |
분자 구조 | |
밀도 | 1.572g/cm3 |
녹는 점 | -24℃ |
비등점 | 218.5°C at 760 mmHg |
굴절 지수 | 1.584 |
인화점 | 89.7°C |
증기압 | 0.125mmHg at 25°C |
위험성 표시 | C##Corrosive:; |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S25##Avoid contact with eyes.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |